C11H14NO2+ — CID 23390867
6-methoxy-3,8-dimethyl-2H-1,3-benzoxazin-3-ium (PubChem CID 23390867) has the molecular formula C11H14NO2+ and a molecular weight of 192.24 g/mol. Its IUPAC name is 6-methoxy-3,8-dimethyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 6-methoxy-3,8-dimethyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 23390867 |
| Molecular Formula | C11H14NO2+ |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 6-methoxy-3,8-dimethyl-2H-1,3-benzoxazin-3-ium |
| SMILES | COc1cc(C)c2c(c1)C=[N+](C)CO2 |
| InChI | InChI=1S/C11H14NO2/c1-8-4-10(13-3)5-9-6-12(2)7-14-11(8)9/h4-6H,7H2,1-3H3/q+1 |
| InChIKey | IPKHGZWXORHSLD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|