C19H25BO3 — CID 642713
methoxy-bis(4-methoxy-2,6-dimethylphenyl)borane (PubChem CID 642713) has the molecular formula C19H25BO3 and a molecular weight of 312.22 g/mol. Its IUPAC name is methoxy-bis(4-methoxy-2,6-dimethylphenyl)borane.
| Compound Name | methoxy-bis(4-methoxy-2,6-dimethylphenyl)borane |
|---|---|
| PubChem CID | 642713 |
| Molecular Formula | C19H25BO3 |
| Molecular Weight | 312.22 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | methoxy-bis(4-methoxy-2,6-dimethylphenyl)borane |
| SMILES | COB(c1c(C)cc(OC)cc1C)c1c(C)cc(OC)cc1C |
| InChI | InChI=1S/C19H25BO3/c1-12-8-16(21-5)9-13(2)18(12)20(23-7)19-14(3)10-17(22-6)11-15(19)4/h8-11H,1-7H3 |
| InChIKey | CJWJQIVAGRZDQV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|