C22H33BO2Si — CID 14362702
bis(4-methoxy-2,6-dimethylphenyl)boranylmethyl-trimethylsilane (PubChem CID 14362702) has the molecular formula C22H33BO2Si and a molecular weight of 368.40 g/mol. Its IUPAC name is bis(4-methoxy-2,6-dimethylphenyl)boranylmethyl-trimethylsilane.
| Compound Name | bis(4-methoxy-2,6-dimethylphenyl)boranylmethyl-trimethylsilane |
|---|---|
| PubChem CID | 14362702 |
| Molecular Formula | C22H33BO2Si |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | bis(4-methoxy-2,6-dimethylphenyl)boranylmethyl-trimethylsilane |
| SMILES | COc1cc(C)c(B(C[Si](C)(C)C)c2c(C)cc(OC)cc2C)c(C)c1 |
| InChI | InChI=1S/C22H33BO2Si/c1-15-10-19(24-5)11-16(2)21(15)23(14-26(7,8)9)22-17(3)12-20(25-6)13-18(22)4/h10-13H,14H2,1-9H3 |
| InChIKey | UEHNZXIBKBAFMD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|