C12H16INO2 — CID 117055383
5,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide (PubChem CID 117055383) has the molecular formula C12H16INO2 and a molecular weight of 333.17 g/mol. Its IUPAC name is 5,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide.
| Compound Name | 5,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide |
|---|---|
| PubChem CID | 117055383 |
| Molecular Formula | C12H16INO2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 5,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium iodide |
| SMILES | COc1cc2c(c(OC)c1)CC[N+](C)=C2.[I-] |
| InChI | InChI=1S/C12H16NO2.HI/c1-13-5-4-11-9(8-13)6-10(14-2)7-12(11)15-3;/h6-8H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OQJRMKQYBRESSW-UHFFFAOYSA-M |
| XLogP | -1.67 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|