C11H13BrO2 — CID 61384882
1-bromo-4,6-dimethoxy-2,3-dihydro-1H-indene (PubChem CID 61384882) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is 1-bromo-4,6-dimethoxy-2,3-dihydro-1H-indene.
| Compound Name | 1-bromo-4,6-dimethoxy-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 61384882 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 1-bromo-4,6-dimethoxy-2,3-dihydro-1H-indene |
| SMILES | COc1cc(OC)c2c(c1)C(Br)CC2 |
| InChI | InChI=1S/C11H13BrO2/c1-13-7-5-9-8(3-4-10(9)12)11(6-7)14-2/h5-6,10H,3-4H2,1-2H3 |
| InChIKey | QEZGBDLVUZCUQP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|