C12H17NO2 — CID 10512521
5,7-dimethoxy-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 10512521) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 5,7-dimethoxy-1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 5,7-dimethoxy-1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 10512521 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 5,7-dimethoxy-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | COc1cc(OC)c2c(c1)N(C)CCC2 |
| InChI | InChI=1S/C12H17NO2/c1-13-6-4-5-10-11(13)7-9(14-2)8-12(10)15-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | KFNYMEOLTRYBNF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |