C15H18ClNO2 — CID 168951474
chloromethane;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol (PubChem CID 168951474) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is chloromethane;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol.
| Compound Name | chloromethane;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol |
|---|---|
| PubChem CID | 168951474 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | chloromethane;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol |
| SMILES | CCl.COc1ccc2c(O)cc3c(c2c1)CCN3C |
| InChI | InChI=1S/C14H15NO2.CH3Cl/c1-15-6-5-10-12-7-9(17-2)3-4-11(12)14(16)8-13(10)15;1-2/h3-4,7-8,16H,5-6H2,1-2H3;1H3 |
| InChIKey | CAKJUCRFFMNHEQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|