C27H31ClN2O5 — CID 168951537
chloromethane;5-(2-methoxyethoxy)-1H-indole-2-carbaldehyde;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol (PubChem CID 168951537) has the molecular formula C27H31ClN2O5 and a molecular weight of 499.01 g/mol. Its IUPAC name is chloromethane;5-(2-methoxyethoxy)-1H-indole-2-carbaldehyde;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol.
| Compound Name | chloromethane;5-(2-methoxyethoxy)-1H-indole-2-carbaldehyde;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol |
|---|---|
| PubChem CID | 168951537 |
| Molecular Formula | C27H31ClN2O5 |
| Molecular Weight | 499.01 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | chloromethane;5-(2-methoxyethoxy)-1H-indole-2-carbaldehyde;8-methoxy-3-methyl-1,2-dihydrobenzo[e]indol-5-ol |
| SMILES | CCl.COCCOc1ccc2[nH]c(C=O)cc2c1.COc1ccc2c(O)cc3c(c2c1)CCN3C |
| InChI | InChI=1S/C14H15NO2.C12H13NO3.CH3Cl/c1-15-6-5-10-12-7-9(17-2)3-4-11(12)14(16)8-13(10)15;1-15-4-5-16-11-2-3-12-9(7-11)6-10(8-14)13-12;1-2/h3-4,7-8,16H,5-6H2,1-2H3;2-3,6-8,13H,4-5H2,1H3;1H3 |
| InChIKey | WYJDGSUOJGTBRO-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.01 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|