C32H41ClN4O6 — CID 177228795
[5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indol-2-yl]-(5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl)methanone;chloromethane (PubChem CID 177228795) has the molecular formula C32H41ClN4O6 and a molecular weight of 613.15 g/mol. Its IUPAC name is [5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indol-2-yl]-(5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl)methanone;chloromethane.
| Compound Name | [5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indol-2-yl]-(5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl)methanone;chloromethane |
|---|---|
| PubChem CID | 177228795 |
| Molecular Formula | C32H41ClN4O6 |
| Molecular Weight | 613.15 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | [5-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethyl-methylamino]ethoxy]-1H-indol-2-yl]-(5-hydroxy-9-methyl-1,2-dihydrobenzo[e]indol-3-yl)methanone;chloromethane |
| SMILES | CCl.Cc1cccc2c(O)cc3c(c12)CCN3C(=O)c1cc2cc(OCCN(C)CCOCCOCCON)ccc2[nH]1 |
| InChI | InChI=1S/C31H38N4O6.CH3Cl/c1-21-4-3-5-25-29(36)20-28-24(30(21)25)8-9-35(28)31(37)27-19-22-18-23(6-7-26(22)33-27)40-13-11-34(2)10-12-38-14-15-39-16-17-41-32;1-2/h3-7,18-20,33,36H,8-17,32H2,1-2H3;1H3 |
| InChIKey | RXURNEMOPRFJQG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.15 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|