C13H18NO2+ — CID 58266749
2-ethyl-6,8-dimethoxy-3,4-dihydroisoquinolin-2-ium (PubChem CID 58266749) has the molecular formula C13H18NO2+ and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-ethyl-6,8-dimethoxy-3,4-dihydroisoquinolin-2-ium.
| Compound Name | 2-ethyl-6,8-dimethoxy-3,4-dihydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 58266749 |
| Molecular Formula | C13H18NO2+ |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 2-ethyl-6,8-dimethoxy-3,4-dihydroisoquinolin-2-ium |
| SMILES | CC[N+]1=Cc2c(cc(OC)cc2OC)CC1 |
| InChI | InChI=1S/C13H18NO2/c1-4-14-6-5-10-7-11(15-2)8-13(16-3)12(10)9-14/h7-9H,4-6H2,1-3H3/q+1 |
| InChIKey | DCGVIYFQDIODEO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|