About 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]
6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] (PubChem CID 171987548) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane].
Molecular Properties
| Compound Name | 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] |
| PubChem CID | 171987548 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] |
| SMILES | COc1cc2c(c(OC)c1)C=NC1(CCCCC1)C2 |
| InChI | InChI=1S/C16H21NO2/c1-18-13-8-12-10-16(6-4-3-5-7-16)17-11-14(12)15(9-13)19-2/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | OSUVDSHVFOZPPH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]?
The IUPAC name of 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] (CID 171987548) is 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane].
What is the SMILES notation for 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]?
The canonical SMILES for 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] is COc1cc2c(c(OC)c1)C=NC1(CCCCC1)C2.
What is the InChIKey of 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]?
The InChIKey is OSUVDSHVFOZPPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-18-13-8-12-10-16(6-4-3-5-7-16)17-11-14(12)15(9-13)19-2/h8-9,11H,3-7,10H2,1-2H3.
What are the key properties of 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane]?
6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] has a molecular weight of 259.35 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethoxyspiro[4H-isoquinoline-3,1'-cyclohexane] is sourced from PubChem (CID 171987548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).