C17H25ClO3 — CID 106828424
2-[chloro-(1-methylcyclohexyl)methyl]-1,3,5-trimethoxybenzene (PubChem CID 106828424) has the molecular formula C17H25ClO3 and a molecular weight of 312.84 g/mol. Its IUPAC name is 2-[chloro-(1-methylcyclohexyl)methyl]-1,3,5-trimethoxybenzene.
| Compound Name | 2-[chloro-(1-methylcyclohexyl)methyl]-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 106828424 |
| Molecular Formula | C17H25ClO3 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[chloro-(1-methylcyclohexyl)methyl]-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(C(Cl)C2(C)CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C17H25ClO3/c1-17(8-6-5-7-9-17)16(18)15-13(20-3)10-12(19-2)11-14(15)21-4/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | FMNFCRRKZKBJID-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|