C26H26N8O4+2 — CID 91328034
3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(1,3,5-triazin-2-yl)-2H-1,3-benzoxazin-3-ium (PubChem CID 91328034) has the molecular formula C26H26N8O4+2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(1,3,5-triazin-2-yl)-2H-1,3-benzoxazin-3-ium.
| Compound Name | 3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(1,3,5-triazin-2-yl)-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 91328034 |
| Molecular Formula | C26H26N8O4+2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-8-methyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-(1,3,5-triazin-2-yl)-2H-1,3-benzoxazin-3-ium |
| SMILES | COc1nc(OC)nc([N+]2=Cc3cccc(C)c3OC2)n1.Cc1cccc2c1OC[N+](c1ncncn1)=C2 |
| InChI | InChI=1S/C14H15N4O3.C12H11N4O/c1-9-5-4-6-10-7-18(8-21-11(9)10)12-15-13(19-2)17-14(16-12)20-3;1-9-3-2-4-10-5-16(8-17-11(9)10)12-14-6-13-7-15-12/h4-7H,8H2,1-3H3;2-7H,8H2,1H3/q2*+1 |
| InChIKey | YMAHDZFVIMRCCS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 120.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|