C34H37N2O8PS+2 — CID 90984401
2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfinic acid;[2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] dihydrogen phosphate (PubChem CID 90984401) has the molecular formula C34H37N2O8PS+2 and a molecular weight of 664.72 g/mol. Its IUPAC name is 2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfinic acid;[2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] dihydrogen phosphate.
| Compound Name | 2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfinic acid;[2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 90984401 |
| Molecular Formula | C34H37N2O8PS+2 |
| Molecular Weight | 664.72 g/mol |
| Exact Mass | 664.20 |
| IUPAC Name | 2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)benzenesulfinic acid;[2,6-dimethyl-4-(8-methyl-2H-1,3-benzoxazin-3-ium-3-yl)phenyl] dihydrogen phosphate |
| SMILES | Cc1cc([N+]2=Cc3cccc(C)c3OC2)cc(C)c1OP(=O)(O)O.Cc1cccc2c1OC[N+](c1cc(C)c(S(=O)O)c(C)c1)=C2 |
| InChI | InChI=1S/C17H18NO5P.C17H17NO3S/c1-11-5-4-6-14-9-18(10-22-17(11)14)15-7-12(2)16(13(3)8-15)23-24(19,20)21;1-11-5-4-6-14-9-18(10-21-16(11)14)15-7-12(2)17(22(19)20)13(3)8-15/h4-9H,10H2,1-3H3,(H-,19,20,21);4-9H,10H2,1-3H3/p+2 |
| InChIKey | HJEMAKYAFWBQCX-UHFFFAOYSA-P |
| XLogP | 6.50 |
| TPSA | 128.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.72 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|