C14H13N2O+ — CID 22968438
8-methyl-3-pyridin-2-yl-2H-1,3-benzoxazin-3-ium (PubChem CID 22968438) has the molecular formula C14H13N2O+ and a molecular weight of 225.27 g/mol. Its IUPAC name is 8-methyl-3-pyridin-2-yl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 8-methyl-3-pyridin-2-yl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 22968438 |
| Molecular Formula | C14H13N2O+ |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 8-methyl-3-pyridin-2-yl-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cccc2c1OC[N+](c1ccccn1)=C2 |
| InChI | InChI=1S/C14H13N2O/c1-11-5-4-6-12-9-16(10-17-14(11)12)13-7-2-3-8-15-13/h2-9H,10H2,1H3/q+1 |
| InChIKey | WNAIPUFFPBBUJT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 25.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|