C36H30N2O4S3+2 — CID 91330361
8-(benzenesulfonyl)-3-phenyl-2H-1,3-benzoxazin-3-ium;methyl 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbodithioate (PubChem CID 91330361) has the molecular formula C36H30N2O4S3+2 and a molecular weight of 650.85 g/mol. Its IUPAC name is 8-(benzenesulfonyl)-3-phenyl-2H-1,3-benzoxazin-3-ium;methyl 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbodithioate.
| Compound Name | 8-(benzenesulfonyl)-3-phenyl-2H-1,3-benzoxazin-3-ium;methyl 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbodithioate |
|---|---|
| PubChem CID | 91330361 |
| Molecular Formula | C36H30N2O4S3+2 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | 8-(benzenesulfonyl)-3-phenyl-2H-1,3-benzoxazin-3-ium;methyl 3-phenyl-2H-1,3-benzoxazin-3-ium-8-carbodithioate |
| SMILES | CSC(=S)c1cccc2c1OC[N+](c1ccccc1)=C2.O=S(=O)(c1ccccc1)c1cccc2c1OC[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C20H16NO3S.C16H14NOS2/c22-25(23,18-11-5-2-6-12-18)19-13-7-8-16-14-21(15-24-20(16)19)17-9-3-1-4-10-17;1-20-16(19)14-9-5-6-12-10-17(11-18-15(12)14)13-7-3-2-4-8-13/h1-14H,15H2;2-10H,11H2,1H3/q2*+1 |
| InChIKey | OZEDVDLCUQNVJE-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|