C42H36N2O4S2+2 — CID 91803246
8-methyl-3-phenyl-6-phenylperoxysulfanyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-6-phenylsulfanyl-2H-1,3-benzoxazin-3-ium (PubChem CID 91803246) has the molecular formula C42H36N2O4S2+2 and a molecular weight of 696.89 g/mol. Its IUPAC name is 8-methyl-3-phenyl-6-phenylperoxysulfanyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-6-phenylsulfanyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 8-methyl-3-phenyl-6-phenylperoxysulfanyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-6-phenylsulfanyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 91803246 |
| Molecular Formula | C42H36N2O4S2+2 |
| Molecular Weight | 696.89 g/mol |
| Exact Mass | 696.21 |
| IUPAC Name | 8-methyl-3-phenyl-6-phenylperoxysulfanyl-2H-1,3-benzoxazin-3-ium;8-methyl-3-phenyl-6-phenylsulfanyl-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1cc(SOOc2ccccc2)cc2c1OC[N+](c1ccccc1)=C2.Cc1cc(Sc2ccccc2)cc2c1OC[N+](c1ccccc1)=C2 |
| InChI | InChI=1S/C21H18NO3S.C21H18NOS/c1-16-12-20(26-25-24-19-10-6-3-7-11-19)13-17-14-22(15-23-21(16)17)18-8-4-2-5-9-18;1-16-12-20(24-19-10-6-3-7-11-19)13-17-14-22(15-23-21(16)17)18-8-4-2-5-9-18/h2-14H,15H2,1H3;2-14H,15H2,1H3/q2*+1 |
| InChIKey | QCWLHTYCIUVEOL-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 42.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.89 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|