C16H17N2O+ — CID 20784355
N,N-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium-6-amine (PubChem CID 20784355) has the molecular formula C16H17N2O+ and a molecular weight of 253.33 g/mol. Its IUPAC name is N,N-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium-6-amine.
| Compound Name | N,N-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium-6-amine |
|---|---|
| PubChem CID | 20784355 |
| Molecular Formula | C16H17N2O+ |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N,N-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium-6-amine |
| SMILES | CN(C)c1ccc2c(c1)C=[N+](c1ccccc1)CO2 |
| InChI | InChI=1S/C16H17N2O/c1-17(2)15-8-9-16-13(10-15)11-18(12-19-16)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3/q+1 |
| InChIKey | BWATYHGFGXAIQR-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|