C16H16NO+ — CID 22968411
5,6-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium (PubChem CID 22968411) has the molecular formula C16H16NO+ and a molecular weight of 238.31 g/mol. Its IUPAC name is 5,6-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium.
| Compound Name | 5,6-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium |
|---|---|
| PubChem CID | 22968411 |
| Molecular Formula | C16H16NO+ |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 5,6-dimethyl-3-phenyl-2H-1,3-benzoxazin-3-ium |
| SMILES | Cc1ccc2c(c1C)C=[N+](c1ccccc1)CO2 |
| InChI | InChI=1S/C16H16NO/c1-12-8-9-16-15(13(12)2)10-17(11-18-16)14-6-4-3-5-7-14/h3-10H,11H2,1-2H3/q+1 |
| InChIKey | OKPDOWCZHNTDGO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|