C21H24N4O2+2 — CID 20784283
6-N,6-N,17-N,17-N-tetramethyl-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene-6,17-diamine (PubChem CID 20784283) has the molecular formula C21H24N4O2+2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 6-N,6-N,17-N,17-N-tetramethyl-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene-6,17-diamine.
| Compound Name | 6-N,6-N,17-N,17-N-tetramethyl-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene-6,17-diamine |
|---|---|
| PubChem CID | 20784283 |
| Molecular Formula | C21H24N4O2+2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 6-N,6-N,17-N,17-N-tetramethyl-2,21-dioxa-10,13-diazoniapentacyclo[11.8.0.01,10.03,8.015,20]henicosa-3(8),4,6,9,13,15(20),16,18-octaene-6,17-diamine |
| SMILES | CN(C)c1ccc2c(c1)C=[N+]1CC[N+]3=Cc4cc(N(C)C)ccc4OC13O2 |
| InChI | InChI=1S/C21H24N4O2/c1-22(2)17-5-7-19-15(11-17)13-24-9-10-25-14-16-12-18(23(3)4)6-8-20(16)27-21(24,25)26-19/h5-8,11-14H,9-10H2,1-4H3/q+2 |
| InChIKey | VLQAWQUHZNAKAU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|