C20H30N2Si2+2 — CID 21343063
trimethyl-(3-phenyl-1-trimethylsilyl-2H-quinazoline-1,3-diium-1-yl)silane (PubChem CID 21343063) has the molecular formula C20H30N2Si2+2 and a molecular weight of 354.65 g/mol. Its IUPAC name is trimethyl-(3-phenyl-1-trimethylsilyl-2H-quinazoline-1,3-diium-1-yl)silane.
| Compound Name | trimethyl-(3-phenyl-1-trimethylsilyl-2H-quinazoline-1,3-diium-1-yl)silane |
|---|---|
| PubChem CID | 21343063 |
| Molecular Formula | C20H30N2Si2+2 |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | trimethyl-(3-phenyl-1-trimethylsilyl-2H-quinazoline-1,3-diium-1-yl)silane |
| SMILES | C[Si](C)(C)[N+]1([Si](C)(C)C)C[N+](c2ccccc2)=Cc2ccccc21 |
| InChI | InChI=1S/C20H30N2Si2/c1-23(2,3)22(24(4,5)6)17-21(19-13-8-7-9-14-19)16-18-12-10-11-15-20(18)22/h7-16H,17H2,1-6H3/q+2 |
| InChIKey | DMYLZULPQDEWHV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|