C44H84N2O3 — CID 21348366
(E)-N-[3-(2-hydroxyethyl)-3-methyl-5-[[(E)-octadec-8-enoyl]amino]pentyl]octadec-8-enamide (PubChem CID 21348366) has the molecular formula C44H84N2O3 and a molecular weight of 689.17 g/mol. Its IUPAC name is (E)-N-[3-(2-hydroxyethyl)-3-methyl-5-[[(E)-octadec-8-enoyl]amino]pentyl]octadec-8-enamide.
| Compound Name | (E)-N-[3-(2-hydroxyethyl)-3-methyl-5-[[(E)-octadec-8-enoyl]amino]pentyl]octadec-8-enamide |
|---|---|
| PubChem CID | 21348366 |
| Molecular Formula | C44H84N2O3 |
| Molecular Weight | 689.17 g/mol |
| Exact Mass | 688.65 |
| IUPAC Name | (E)-N-[3-(2-hydroxyethyl)-3-methyl-5-[[(E)-octadec-8-enoyl]amino]pentyl]octadec-8-enamide |
| SMILES | CCCCCCCCC/C=C/CCCCCCC(=O)NCCC(C)(CCO)CCNC(=O)CCCCCC/C=C/CCCCCCCCC |
| InChI | InChI=1S/C44H84N2O3/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-42(48)45-39-36-44(3,38-41-47)37-40-46-43(49)35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h20-23,47H,4-19,24-41H2,1-3H3,(H,45,48)(H,46,49)/b22-20+,23-21+ |
| InChIKey | QNQGURLAVHAGPC-DQPVQCHKSA-N |
| XLogP | 12.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.17 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|