C22H41NO2 — CID 163319736
(Z,2R)-2-ethyl-N-[(E,4R,5R)-4-ethyl-5-hydroxy-8-methyldec-8-enyl]hept-5-enamide (PubChem CID 163319736) has the molecular formula C22H41NO2 and a molecular weight of 351.58 g/mol. Its IUPAC name is (Z,2R)-2-ethyl-N-[(E,4R,5R)-4-ethyl-5-hydroxy-8-methyldec-8-enyl]hept-5-enamide.
| Compound Name | (Z,2R)-2-ethyl-N-[(E,4R,5R)-4-ethyl-5-hydroxy-8-methyldec-8-enyl]hept-5-enamide |
|---|---|
| PubChem CID | 163319736 |
| Molecular Formula | C22H41NO2 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 351.31 |
| IUPAC Name | (Z,2R)-2-ethyl-N-[(E,4R,5R)-4-ethyl-5-hydroxy-8-methyldec-8-enyl]hept-5-enamide |
| SMILES | C/C=C\CCC(CC)C(=O)NCCC[C@@H](CC)[C@H](O)CC/C(C)=C/C |
| InChI | InChI=1S/C22H41NO2/c1-6-10-11-13-20(9-4)22(25)23-17-12-14-19(8-3)21(24)16-15-18(5)7-2/h6-7,10,19-21,24H,8-9,11-17H2,1-5H3,(H,23,25)/b10-6-,18-7+/t19-,20?,21-/m1/s1 |
| InChIKey | GALYYGVBCXQKNY-UICKJIGMSA-N |
| XLogP | 5.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|