C28H55NO2Si — CID 163319722
(Z,2R)-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide (PubChem CID 163319722) has the molecular formula C28H55NO2Si and a molecular weight of 465.84 g/mol. Its IUPAC name is (Z,2R)-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide.
| Compound Name | (Z,2R)-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide |
|---|---|
| PubChem CID | 163319722 |
| Molecular Formula | C28H55NO2Si |
| Molecular Weight | 465.84 g/mol |
| Exact Mass | 465.40 |
| IUPAC Name | (Z,2R)-N-[(E,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-ethyl-8-methyldec-8-enyl]-2-ethylhept-5-enamide |
| SMILES | C/C=C\CCC(CC)C(=O)NCCC[C@@H](CC)[C@@H](CC/C(C)=C/C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H55NO2Si/c1-11-15-16-18-25(14-4)27(30)29-22-17-19-24(13-3)26(21-20-23(5)12-2)31-32(9,10)28(6,7)8/h11-12,15,24-26H,13-14,16-22H2,1-10H3,(H,29,30)/b15-11-,23-12+/t24-,25?,26-/m1/s1 |
| InChIKey | RLVMYMGKZSQNPX-FLKDCCTPSA-N |
| XLogP | 8.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.84 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|