C15H19IO3 — CID 21348780
1-(3-iodo-5-methyl-4-propoxyphenyl)pentane-1,4-dione (PubChem CID 21348780) has the molecular formula C15H19IO3 and a molecular weight of 374.22 g/mol. Its IUPAC name is 1-(3-iodo-5-methyl-4-propoxyphenyl)pentane-1,4-dione.
| Compound Name | 1-(3-iodo-5-methyl-4-propoxyphenyl)pentane-1,4-dione |
|---|---|
| PubChem CID | 21348780 |
| Molecular Formula | C15H19IO3 |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 1-(3-iodo-5-methyl-4-propoxyphenyl)pentane-1,4-dione |
| SMILES | CCCOc1c(C)cc(C(=O)CCC(C)=O)cc1I |
| InChI | InChI=1S/C15H19IO3/c1-4-7-19-15-10(2)8-12(9-13(15)16)14(18)6-5-11(3)17/h8-9H,4-7H2,1-3H3 |
| InChIKey | UVKJTSXRKZMPLV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|