C13H19NO6 — CID 21350407
(3S,6R)-3-tert-butyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylic acid (PubChem CID 21350407) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (3S,6R)-3-tert-butyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylic acid.
| Compound Name | (3S,6R)-3-tert-butyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylic acid |
|---|---|
| PubChem CID | 21350407 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (3S,6R)-3-tert-butyl-6-methyl-5-oxo-3,7-dihydro-1H-pyrrolo[1,2-c][1,3]oxazole-6,7a-dicarboxylic acid |
| SMILES | CC(C)(C)[C@@H]1OCC2(C(=O)O)C[C@@](C)(C(=O)O)C(=O)N12 |
| InChI | InChI=1S/C13H19NO6/c1-11(2,3)8-14-7(15)12(4,9(16)17)5-13(14,6-20-8)10(18)19/h8H,5-6H2,1-4H3,(H,16,17)(H,18,19)/t8-,12+,13?/m0/s1 |
| InChIKey | CNAJJFGLRLRHIQ-ITCHVEPBSA-N |
| XLogP | 0.54 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|