C29H46N8O5 — CID 21350554
1-acetamido-N-[1-[[1-[(1-amino-1-oxobutan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylcyclohexane-1-carboxamide (PubChem CID 21350554) has the molecular formula C29H46N8O5 and a molecular weight of 586.74 g/mol. Its IUPAC name is 1-acetamido-N-[1-[[1-[(1-amino-1-oxobutan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylcyclohexane-1-carboxamide.
| Compound Name | 1-acetamido-N-[1-[[1-[(1-amino-1-oxobutan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 21350554 |
| Molecular Formula | C29H46N8O5 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.36 |
| IUPAC Name | 1-acetamido-N-[1-[[1-[(1-amino-1-oxobutan-2-yl)amino]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]-4-methylcyclohexane-1-carboxamide |
| SMILES | CCC(NC(=O)C(CCCN=C(N)N)NC(=O)C(Cc1ccccc1)NC(=O)C1(NC(C)=O)CCC(C)CC1)C(N)=O |
| InChI | InChI=1S/C29H46N8O5/c1-4-21(24(30)39)34-25(40)22(11-8-16-33-28(31)32)35-26(41)23(17-20-9-6-5-7-10-20)36-27(42)29(37-19(3)38)14-12-18(2)13-15-29/h5-7,9-10,18,21-23H,4,8,11-17H2,1-3H3,(H2,30,39)(H,34,40)(H,35,41)(H,36,42)(H,37,38)(H4,31,32,33) |
| InChIKey | XKVJZXIVZOKGGD-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 223.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|