C42H45F3N4O — CID 21352466
N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine (PubChem CID 21352466) has the molecular formula C42H45F3N4O and a molecular weight of 678.84 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 21352466 |
| Molecular Formula | C42H45F3N4O |
| Molecular Weight | 678.84 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-N,1-bis[[5-(3,4,5-trimethylphenyl)-3-pyridinyl]methyl]piperidin-4-amine |
| SMILES | Cc1cc(-c2cncc(CN3CCC(N(Cc4cncc(-c5cc(C)c(C)c(C)c5)c4)c4ccc(OC(F)(F)F)cc4)CC3)c2)cc(C)c1C |
| InChI | InChI=1S/C42H45F3N4O/c1-27-15-35(16-28(2)31(27)5)37-19-33(21-46-23-37)25-48-13-11-40(12-14-48)49(39-7-9-41(10-8-39)50-42(43,44)45)26-34-20-38(24-47-22-34)36-17-29(3)32(6)30(4)18-36/h7-10,15-24,40H,11-14,25-26H2,1-6H3 |
| InChIKey | SRMRBOFJJLUJJD-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.84 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|