C25H25ClN4O4 — CID 21352718
(1-pyridin-4-ylpiperidin-4-yl)methyl N-[2-[(4-chlorobenzoyl)amino]-5-hydroxyphenyl]carbamate (PubChem CID 21352718) has the molecular formula C25H25ClN4O4 and a molecular weight of 480.95 g/mol. Its IUPAC name is (1-pyridin-4-ylpiperidin-4-yl)methyl N-[2-[(4-chlorobenzoyl)amino]-5-hydroxyphenyl]carbamate.
| Compound Name | (1-pyridin-4-ylpiperidin-4-yl)methyl N-[2-[(4-chlorobenzoyl)amino]-5-hydroxyphenyl]carbamate |
|---|---|
| PubChem CID | 21352718 |
| Molecular Formula | C25H25ClN4O4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (1-pyridin-4-ylpiperidin-4-yl)methyl N-[2-[(4-chlorobenzoyl)amino]-5-hydroxyphenyl]carbamate |
| SMILES | O=C(Nc1cc(O)ccc1NC(=O)c1ccc(Cl)cc1)OCC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C25H25ClN4O4/c26-19-3-1-18(2-4-19)24(32)28-22-6-5-21(31)15-23(22)29-25(33)34-16-17-9-13-30(14-10-17)20-7-11-27-12-8-20/h1-8,11-12,15,17,31H,9-10,13-14,16H2,(H,28,32)(H,29,33) |
| InChIKey | OTSRLYBQXPEMNU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|