C8H10N2O3 — CID 21355320
2-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)acetaldehyde (PubChem CID 21355320) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)acetaldehyde.
| Compound Name | 2-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 21355320 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(3,4-dimethyl-2,6-dioxopyrimidin-1-yl)acetaldehyde |
| SMILES | Cc1cc(=O)n(CC=O)c(=O)n1C |
| InChI | InChI=1S/C8H10N2O3/c1-6-5-7(12)10(3-4-11)8(13)9(6)2/h4-5H,3H2,1-2H3 |
| InChIKey | LCHYOLPBIBFKRR-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 61.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|