C16H18N2O2 — CID 21359108
3,8-dimethyl-2,4,7,9-tetrahydro-[1,3]benzoxazino[7,8-f][1,3]benzoxazine (PubChem CID 21359108) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 3,8-dimethyl-2,4,7,9-tetrahydro-[1,3]benzoxazino[7,8-f][1,3]benzoxazine.
| Compound Name | 3,8-dimethyl-2,4,7,9-tetrahydro-[1,3]benzoxazino[7,8-f][1,3]benzoxazine |
|---|---|
| PubChem CID | 21359108 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3,8-dimethyl-2,4,7,9-tetrahydro-[1,3]benzoxazino[7,8-f][1,3]benzoxazine |
| SMILES | CN1COc2c(ccc3c4c(ccc23)OCN(C)C4)C1 |
| InChI | InChI=1S/C16H18N2O2/c1-17-7-11-3-4-12-13(16(11)20-10-17)5-6-15-14(12)8-18(2)9-19-15/h3-6H,7-10H2,1-2H3 |
| InChIKey | JFEAHZQYXWLMCU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |