C35H48O2 — CID 21359867
2-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2-pentylcyclopropyl)phenyl]ethynyl]phenoxy]oxane (PubChem CID 21359867) has the molecular formula C35H48O2 and a molecular weight of 500.77 g/mol. Its IUPAC name is 2-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2-pentylcyclopropyl)phenyl]ethynyl]phenoxy]oxane.
| Compound Name | 2-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2-pentylcyclopropyl)phenyl]ethynyl]phenoxy]oxane |
|---|---|
| PubChem CID | 21359867 |
| Molecular Formula | C35H48O2 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.37 |
| IUPAC Name | 2-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(2-pentylcyclopropyl)phenyl]ethynyl]phenoxy]oxane |
| SMILES | CCCCCC1CC1c1c(C)c(C)c(C#Cc2c(C)c(C)c(OC3CCCCO3)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C35H48O2/c1-10-11-12-15-29-20-32(29)34-25(6)21(2)30(22(3)26(34)7)17-18-31-23(4)27(8)35(28(9)24(31)5)37-33-16-13-14-19-36-33/h29,32-33H,10-16,19-20H2,1-9H3 |
| InChIKey | WBAYXSNEHXYQJD-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|