C26H42O6 — CID 162470187
2-[2-heptyl-5,6-dimethoxy-3-methyl-4-(oxan-2-yloxy)phenoxy]oxane (PubChem CID 162470187) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is 2-[2-heptyl-5,6-dimethoxy-3-methyl-4-(oxan-2-yloxy)phenoxy]oxane.
| Compound Name | 2-[2-heptyl-5,6-dimethoxy-3-methyl-4-(oxan-2-yloxy)phenoxy]oxane |
|---|---|
| PubChem CID | 162470187 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 2-[2-heptyl-5,6-dimethoxy-3-methyl-4-(oxan-2-yloxy)phenoxy]oxane |
| SMILES | CCCCCCCc1c(C)c(OC2CCCCO2)c(OC)c(OC)c1OC1CCCCO1 |
| InChI | InChI=1S/C26H42O6/c1-5-6-7-8-9-14-20-19(2)23(31-21-15-10-12-17-29-21)25(27-3)26(28-4)24(20)32-22-16-11-13-18-30-22/h21-22H,5-18H2,1-4H3 |
| InChIKey | QJTGEJLSCXVMRV-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|