C21H36O2 — CID 21361797
2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-6-methoxyhexan-2-ol (PubChem CID 21361797) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-6-methoxyhexan-2-ol.
| Compound Name | 2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-6-methoxyhexan-2-ol |
|---|---|
| PubChem CID | 21361797 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 2-(9,10-dimethyl-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)-6-methoxyhexan-2-ol |
| SMILES | COCCCCC(C)(O)C1CC2CC1C1C3CC(C(C)C3C)C21 |
| InChI | InChI=1S/C21H36O2/c1-12-13(2)16-11-15(12)19-14-9-17(20(16)19)18(10-14)21(3,22)7-5-6-8-23-4/h12-20,22H,5-11H2,1-4H3 |
| InChIKey | SZKULOYJBXYANQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|