C19H31N3 — CID 21362812
2-N-ethyl-2-N-[(1-methylpiperidin-4-yl)methyl]-1,2,3,4-tetrahydronaphthalene-2,7-diamine (PubChem CID 21362812) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is 2-N-ethyl-2-N-[(1-methylpiperidin-4-yl)methyl]-1,2,3,4-tetrahydronaphthalene-2,7-diamine.
| Compound Name | 2-N-ethyl-2-N-[(1-methylpiperidin-4-yl)methyl]-1,2,3,4-tetrahydronaphthalene-2,7-diamine |
|---|---|
| PubChem CID | 21362812 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 2-N-ethyl-2-N-[(1-methylpiperidin-4-yl)methyl]-1,2,3,4-tetrahydronaphthalene-2,7-diamine |
| SMILES | CCN(CC1CCN(C)CC1)C1CCc2ccc(N)cc2C1 |
| InChI | InChI=1S/C19H31N3/c1-3-22(14-15-8-10-21(2)11-9-15)19-7-5-16-4-6-18(20)12-17(16)13-19/h4,6,12,15,19H,3,5,7-11,13-14,20H2,1-2H3 |
| InChIKey | GLXFWLITRSNGGU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|