C18H27N3O — CID 142248602
4-[[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]methyl]piperidine-1-carbaldehyde (PubChem CID 142248602) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 4-[[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]methyl]piperidine-1-carbaldehyde.
| Compound Name | 4-[[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]methyl]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 142248602 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 4-[[(7-amino-1,2,3,4-tetrahydronaphthalen-2-yl)-methylamino]methyl]piperidine-1-carbaldehyde |
| SMILES | CN(CC1CCN(C=O)CC1)C1CCc2ccc(N)cc2C1 |
| InChI | InChI=1S/C18H27N3O/c1-20(12-14-6-8-21(13-22)9-7-14)18-5-3-15-2-4-17(19)10-16(15)11-18/h2,4,10,13-14,18H,3,5-9,11-12,19H2,1H3 |
| InChIKey | NHLPMRLVFTXVMO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|