C28H40N2O5 — CID 21363560
1-(1-hydroxy-2-methyl-5-propan-2-ylcyclohexyl)-2-[2-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]ethane-1,2-dione (PubChem CID 21363560) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is 1-(1-hydroxy-2-methyl-5-propan-2-ylcyclohexyl)-2-[2-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]ethane-1,2-dione.
| Compound Name | 1-(1-hydroxy-2-methyl-5-propan-2-ylcyclohexyl)-2-[2-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 21363560 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 1-(1-hydroxy-2-methyl-5-propan-2-ylcyclohexyl)-2-[2-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonan-9-yl]ethane-1,2-dione |
| SMILES | CC(C)C1CCC(C)C(O)(C(=O)C(=O)N2C3CCCC2C(=O)N(CCOCc2ccccc2)C3)C1 |
| InChI | InChI=1S/C28H40N2O5/c1-19(2)22-13-12-20(3)28(34,16-22)25(31)27(33)30-23-10-7-11-24(30)26(32)29(17-23)14-15-35-18-21-8-5-4-6-9-21/h4-6,8-9,19-20,22-24,34H,7,10-18H2,1-3H3 |
| InChIKey | RQYYKAIZLVILBR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|