C18H24N2O5 — CID 22987899
2-methoxy-4-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonane-9-carboxylic acid (PubChem CID 22987899) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-methoxy-4-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonane-9-carboxylic acid.
| Compound Name | 2-methoxy-4-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 22987899 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-methoxy-4-oxo-3-(2-phenylmethoxyethyl)-3,9-diazabicyclo[3.3.1]nonane-9-carboxylic acid |
| SMILES | COC1C2CCCC(C(=O)N1CCOCc1ccccc1)N2C(=O)O |
| InChI | InChI=1S/C18H24N2O5/c1-24-17-15-9-5-8-14(20(15)18(22)23)16(21)19(17)10-11-25-12-13-6-3-2-4-7-13/h2-4,6-7,14-15,17H,5,8-12H2,1H3,(H,22,23) |
| InChIKey | DOPQDFLISIANJT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|