C15H18N2S — CID 21365788
4-methyl-2-(1-methylpyrrolidin-2-yl)-5-phenyl-1,3-thiazole (PubChem CID 21365788) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 4-methyl-2-(1-methylpyrrolidin-2-yl)-5-phenyl-1,3-thiazole.
| Compound Name | 4-methyl-2-(1-methylpyrrolidin-2-yl)-5-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 21365788 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-methyl-2-(1-methylpyrrolidin-2-yl)-5-phenyl-1,3-thiazole |
| SMILES | Cc1nc(C2CCCN2C)sc1-c1ccccc1 |
| InChI | InChI=1S/C15H18N2S/c1-11-14(12-7-4-3-5-8-12)18-15(16-11)13-9-6-10-17(13)2/h3-5,7-8,13H,6,9-10H2,1-2H3 |
| InChIKey | JGSCLRSNFZMOJR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |