C15H14N4O4 — CID 21365954
1-ethyl-3-[6-(3-hydroxy-4-oxopyran-2-yl)-1H-benzimidazol-2-yl]urea (PubChem CID 21365954) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is 1-ethyl-3-[6-(3-hydroxy-4-oxopyran-2-yl)-1H-benzimidazol-2-yl]urea.
| Compound Name | 1-ethyl-3-[6-(3-hydroxy-4-oxopyran-2-yl)-1H-benzimidazol-2-yl]urea |
|---|---|
| PubChem CID | 21365954 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-ethyl-3-[6-(3-hydroxy-4-oxopyran-2-yl)-1H-benzimidazol-2-yl]urea |
| SMILES | CCNC(=O)Nc1nc2ccc(-c3occc(=O)c3O)cc2[nH]1 |
| InChI | InChI=1S/C15H14N4O4/c1-2-16-15(22)19-14-17-9-4-3-8(7-10(9)18-14)13-12(21)11(20)5-6-23-13/h3-7,21H,2H2,1H3,(H3,16,17,18,19,22) |
| InChIKey | XBTHGTVVAJFCFN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |