C27H30N2O5 — CID 21367574
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-methylphenoxy)propanoylamino]benzamide (PubChem CID 21367574) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-methylphenoxy)propanoylamino]benzamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-methylphenoxy)propanoylamino]benzamide |
|---|---|
| PubChem CID | 21367574 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[2-(3-methylphenoxy)propanoylamino]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccccc2NC(=O)C(C)Oc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C27H30N2O5/c1-18-8-7-9-21(16-18)34-19(2)26(30)29-23-11-6-5-10-22(23)27(31)28-15-14-20-12-13-24(32-3)25(17-20)33-4/h5-13,16-17,19H,14-15H2,1-4H3,(H,28,31)(H,29,30) |
| InChIKey | KVWVJDZTUVABGB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |