C28H32N2O6 — CID 42561404
2-[(2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-1-oxopropan-2-yl]oxy-N-(2-phenoxyethyl)benzamide (PubChem CID 42561404) has the molecular formula C28H32N2O6 and a molecular weight of 492.57 g/mol. Its IUPAC name is 2-[(2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-1-oxopropan-2-yl]oxy-N-(2-phenoxyethyl)benzamide.
| Compound Name | 2-[(2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-1-oxopropan-2-yl]oxy-N-(2-phenoxyethyl)benzamide |
|---|---|
| PubChem CID | 42561404 |
| Molecular Formula | C28H32N2O6 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 2-[(2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-1-oxopropan-2-yl]oxy-N-(2-phenoxyethyl)benzamide |
| SMILES | COc1ccc(CCNC(=O)[C@@H](C)Oc2ccccc2C(=O)NCCOc2ccccc2)cc1OC |
| InChI | InChI=1S/C28H32N2O6/c1-20(27(31)29-16-15-21-13-14-25(33-2)26(19-21)34-3)36-24-12-8-7-11-23(24)28(32)30-17-18-35-22-9-5-4-6-10-22/h4-14,19-20H,15-18H2,1-3H3,(H,29,31)(H,30,32)/t20-/m1/s1 |
| InChIKey | AGVGLGBNYIHBFH-HXUWFJFHSA-N |
| XLogP | 3.64 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|