C24H28N4O2 — CID 21369305
N-(1-butyl-3,5-dimethylpyrazol-4-yl)-4-[(2-phenylacetyl)amino]benzamide (PubChem CID 21369305) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-(1-butyl-3,5-dimethylpyrazol-4-yl)-4-[(2-phenylacetyl)amino]benzamide.
| Compound Name | N-(1-butyl-3,5-dimethylpyrazol-4-yl)-4-[(2-phenylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 21369305 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-(1-butyl-3,5-dimethylpyrazol-4-yl)-4-[(2-phenylacetyl)amino]benzamide |
| SMILES | CCCCn1nc(C)c(NC(=O)c2ccc(NC(=O)Cc3ccccc3)cc2)c1C |
| InChI | InChI=1S/C24H28N4O2/c1-4-5-15-28-18(3)23(17(2)27-28)26-24(30)20-11-13-21(14-12-20)25-22(29)16-19-9-7-6-8-10-19/h6-14H,4-5,15-16H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | PEWDODXLUONQCB-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |