C20H26N4O2 — CID 21369339
4-[[(E)-but-2-enoyl]amino]-N-(1-butyl-3,5-dimethylpyrazol-4-yl)benzamide (PubChem CID 21369339) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 4-[[(E)-but-2-enoyl]amino]-N-(1-butyl-3,5-dimethylpyrazol-4-yl)benzamide.
| Compound Name | 4-[[(E)-but-2-enoyl]amino]-N-(1-butyl-3,5-dimethylpyrazol-4-yl)benzamide |
|---|---|
| PubChem CID | 21369339 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 4-[[(E)-but-2-enoyl]amino]-N-(1-butyl-3,5-dimethylpyrazol-4-yl)benzamide |
| SMILES | C/C=C/C(=O)Nc1ccc(C(=O)Nc2c(C)nn(CCCC)c2C)cc1 |
| InChI | InChI=1S/C20H26N4O2/c1-5-7-13-24-15(4)19(14(3)23-24)22-20(26)16-9-11-17(12-10-16)21-18(25)8-6-2/h6,8-12H,5,7,13H2,1-4H3,(H,21,25)(H,22,26)/b8-6+ |
| InChIKey | ZXUBTXHQISTYDK-SOFGYWHQSA-N |
| XLogP | 4.07 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|