C10H15N3O — CID 110470173
(E)-N-(1,3,5-trimethylpyrazol-4-yl)but-2-enamide (PubChem CID 110470173) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is (E)-N-(1,3,5-trimethylpyrazol-4-yl)but-2-enamide.
| Compound Name | (E)-N-(1,3,5-trimethylpyrazol-4-yl)but-2-enamide |
|---|---|
| PubChem CID | 110470173 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (E)-N-(1,3,5-trimethylpyrazol-4-yl)but-2-enamide |
| SMILES | C/C=C/C(=O)Nc1c(C)nn(C)c1C |
| InChI | InChI=1S/C10H15N3O/c1-5-6-9(14)11-10-7(2)12-13(4)8(10)3/h5-6H,1-4H3,(H,11,14)/b6-5+ |
| InChIKey | MLELTMFVUZKRLH-AATRIKPKSA-N |
| XLogP | 1.55 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|