C22H22N2O5 — CID 21373233
methyl (4Z)-4-[(3-ethoxy-2-hydroxyphenyl)methylidene]-2-methyl-5-oxo-1-(pyridin-3-ylmethyl)pyrrole-3-carboxylate (PubChem CID 21373233) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is methyl (4Z)-4-[(3-ethoxy-2-hydroxyphenyl)methylidene]-2-methyl-5-oxo-1-(pyridin-3-ylmethyl)pyrrole-3-carboxylate.
| Compound Name | methyl (4Z)-4-[(3-ethoxy-2-hydroxyphenyl)methylidene]-2-methyl-5-oxo-1-(pyridin-3-ylmethyl)pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 21373233 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | methyl (4Z)-4-[(3-ethoxy-2-hydroxyphenyl)methylidene]-2-methyl-5-oxo-1-(pyridin-3-ylmethyl)pyrrole-3-carboxylate |
| SMILES | CCOc1cccc(/C=C2\C(=O)N(Cc3cccnc3)C(C)=C2C(=O)OC)c1O |
| InChI | InChI=1S/C22H22N2O5/c1-4-29-18-9-5-8-16(20(18)25)11-17-19(22(27)28-3)14(2)24(21(17)26)13-15-7-6-10-23-12-15/h5-12,25H,4,13H2,1-3H3/b17-11- |
| InChIKey | IRFAXIFADCXSKK-BOPFTXTBSA-N |
| XLogP | 3.06 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|