C18H13BrF3NO3 — CID 21373986
(3E)-3-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one (PubChem CID 21373986) has the molecular formula C18H13BrF3NO3 and a molecular weight of 428.20 g/mol. Its IUPAC name is (3E)-3-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one.
| Compound Name | (3E)-3-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 21373986 |
| Molecular Formula | C18H13BrF3NO3 |
| Molecular Weight | 428.20 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | (3E)-3-[(5-bromo-2,4-dimethoxyphenyl)methylidene]-6-(trifluoromethyl)-1H-indol-2-one |
| SMILES | COc1cc(OC)c(/C=C2/C(=O)Nc3cc(C(F)(F)F)ccc32)cc1Br |
| InChI | InChI=1S/C18H13BrF3NO3/c1-25-15-8-16(26-2)13(19)6-9(15)5-12-11-4-3-10(18(20,21)22)7-14(11)23-17(12)24/h3-8H,1-2H3,(H,23,24)/b12-5+ |
| InChIKey | LEUNJFJRSUOYHE-LFYBBSHMSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.20 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|