C14H18F3NOS — CID 21391063
1-[3-[3-(trifluoromethyl)phenyl]sulfinylpropyl]pyrrolidine (PubChem CID 21391063) has the molecular formula C14H18F3NOS and a molecular weight of 305.36 g/mol. Its IUPAC name is 1-[3-[3-(trifluoromethyl)phenyl]sulfinylpropyl]pyrrolidine.
| Compound Name | 1-[3-[3-(trifluoromethyl)phenyl]sulfinylpropyl]pyrrolidine |
|---|---|
| PubChem CID | 21391063 |
| Molecular Formula | C14H18F3NOS |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1-[3-[3-(trifluoromethyl)phenyl]sulfinylpropyl]pyrrolidine |
| SMILES | O=S(CCCN1CCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NOS/c15-14(16,17)12-5-3-6-13(11-12)20(19)10-4-9-18-7-1-2-8-18/h3,5-6,11H,1-2,4,7-10H2 |
| InChIKey | OCUCINHEPIXEKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |