About 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole
1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole (PubChem CID 21392802) has the molecular formula C9H7N3OS
and a molecular weight of 205.24 g/mol. Its IUPAC name is 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole.
Analyze 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole?
The IUPAC name of 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole (CID 21392802) is 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole.
What is the SMILES notation for 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole?
The canonical SMILES for 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole is COc1nnc2sc3ccccc3n12.
What is the InChIKey of 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole?
The InChIKey is ZVGZKYTWYZALKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3OS/c1-13-8-10-11-9-12(8)6-4-2-3-5-7(6)14-9/h2-5H,1H3.
What are the key properties of 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole?
1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole has a molecular weight of 205.24 g/mol, XLogP of 1.95, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-[1,2,4]triazolo[3,4-b][1,3]benzothiazole is sourced from PubChem (CID 21392802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).