C10H8Cl3NO3S — CID 21393548
4,5,5-trichloro-4-methyl-1,1-dioxo-2-phenyl-1,2-thiazolidin-3-one (PubChem CID 21393548) has the molecular formula C10H8Cl3NO3S and a molecular weight of 328.60 g/mol. Its IUPAC name is 4,5,5-trichloro-4-methyl-1,1-dioxo-2-phenyl-1,2-thiazolidin-3-one.
| Compound Name | 4,5,5-trichloro-4-methyl-1,1-dioxo-2-phenyl-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 21393548 |
| Molecular Formula | C10H8Cl3NO3S |
| Molecular Weight | 328.60 g/mol |
| Exact Mass | 326.93 |
| IUPAC Name | 4,5,5-trichloro-4-methyl-1,1-dioxo-2-phenyl-1,2-thiazolidin-3-one |
| SMILES | CC1(Cl)C(=O)N(c2ccccc2)S(=O)(=O)C1(Cl)Cl |
| InChI | InChI=1S/C10H8Cl3NO3S/c1-9(11)8(15)14(7-5-3-2-4-6-7)18(16,17)10(9,12)13/h2-6H,1H3 |
| InChIKey | SGIMWPGGOXUMHS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|